Vitamin D: Difference between revisions
No edit summary |
No edit summary |
||
Line 1: | Line 1: | ||
{{#subtitle: colecalciferol}} | {{#subtitle: colecalciferol}} | ||
{{Infobox | {{Short description|Chemical compound}} | ||
| | {{cs1 config|name-list-style=vanc}} | ||
| | {{good article}} | ||
| | {{Distinguish|Thymine}} | ||
| | {{Use dmy dates|date=July 2021}} | ||
| | {{Infobox drug | ||
| | | drug_name = | ||
| | | INN = | ||
| | | type = <!-- empty --> | ||
| | | IUPAC_name = 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol | ||
| | | image = Thiamin.svg | ||
| | | width = | ||
| | | alt = | ||
| | | image2 = Thiamine-cation-from-xtal-3D-bs-17.png | ||
| | | width2 = | ||
| | | alt2 = | ||
| | | imageL = | ||
| widthL = | |||
| altL = | |||
| imageR = | |||
| widthR = | |||
| altR = | |||
| caption = Skeletal formula and ball-and-stick model of the thiamine [[Ion#Anions and cations|cation]] | |||
<!-- Clinical data -->| pronounce = {{IPAc-en|ˈ|θ|aɪ|.|ə|m|ᵻ|n}} {{respell|THY|ə-min}} | |||
| tradename = | |||
| Drugs.com = {{Drugs.com|monograph|thiamine-hydrochloride}} | |||
| MedlinePlus = | |||
| licence_EU = <!-- EMA requires brand name --> | |||
| licence_US = Thiamine | |||
| DailyMedID = Thiamine | |||
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X --> | |||
| pregnancy_AU_comment = | |||
| pregnancy_category = | |||
| dependency_liability = | |||
| addiction_liability = | |||
| routes_of_administration = by mouth, IV, IM<ref name=NIH2016/> | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_AU_comment = | |||
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_CA_comment = | |||
| legal_DE = <!-- Anlage I, II, III or Unscheduled--> | |||
| legal_DE_comment = | |||
| legal_NZ = <!-- Class A, B, C --> | |||
| legal_NZ_comment = | |||
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> | |||
| legal_UK_comment = | |||
| legal_US = OTC | |||
| legal_US_comment = | |||
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV--> | |||
| legal_UN_comment = | |||
| legal_status = <!--For countries not listed above--> | |||
<!-- Pharmacokinetic data -->| bioavailability = 3.7% to 5.3% (Thiamine hydrochloride)<ref>{{cite journal | vauthors = Smithline HA, Donnino M, Greenblatt DJ | title = Pharmacokinetics of high-dose oral thiamine hydrochloride in healthy subjects | journal = BMC Clinical Pharmacology | volume = 12 | issue = 1 | page = 4 | date = February 2012 | pmid = 22305197 | pmc = 3293077 | doi = 10.1186/1472-6904-12-4 | doi-access = free }}</ref> | |||
| protein_bound = | |||
| metabolism = | |||
| metabolites = | |||
| onset = | |||
| elimination_half-life = | |||
| duration_of_action = | |||
| excretion = <!-- Identifiers --> | |||
| CAS_number_Ref = {{cascite|correct|CAS}} | |||
| CAS_number = 70-16-6 | |||
| index_label = cation | |||
| index2_label = Cl<sup>−</sup> salt | |||
| CAS_number2_Ref = {{cascite|correct|CAS}} | |||
| CAS_number2 = 59-43-8 | |||
| CAS_supplemental =<br>{{CAS|67-03-8}}(Cl<sup>−</sup>.HCl) | |||
| UNII2_Ref = {{fdacite|correct|FDA}} | |||
| UNII2 = X66NSO3N35 | |||
| class = [[vitamin]] | |||
| ATCvet = | |||
| ATC_prefix = A11 | |||
| ATC_suffix = DA01 | |||
| ATC_supplemental = | |||
| PubChem = 1130 | |||
| PubChem2 = 6042 | |||
| IUPHAR_ligand = | |||
| DrugBank = DB00152 | |||
| ChemSpiderID = 1098 | |||
| UNII = 4ABT0J945J | |||
| KEGG = C00378 | |||
| ChEBI = 18385 | |||
| ChEMBL = 1547 | |||
| NIAID_ChemDB = | |||
| synonyms = Vitamin B<sub>1</sub>, aneurine, thiamin | |||
<!-- Chemical and physical data -->| chemical_formula = | C= 12| H= 17| N= 4| O= 1| S= 1 | |||
| charge = + | |||
| SMILES = Cc2ncc(C[n+]1csc(CCO)c1C)c(N)n2 | |||
| Jmol = | |||
| StdInChI = 1S/C12H17N4OS/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15)/q+1 | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = JZRWCGZRTZMZEH-UHFFFAOYSA-N | |||
<!--| InChIKey1 = MYVIATVLJGTBFV-UHFFFAOYSA-M | |||
| InChIKey2 = DPJRMOMPQZCRJU-UHFFFAOYSA-M | |||
StdInChI and key are for cation, extra Inchikey for Cl- salt and Cl-.HCl, so search engines will find this page. Source=CAS --> | |||
| density = | |||
| density_notes = | |||
| melting_point = | |||
| melting_high = | |||
| melting_notes = | |||
| boiling_point = | |||
| boiling_notes = | |||
| solubility = | |||
| specific_rotation = | |||
}} | }} | ||
Revision as of 22:48, 24 February 2024
{{#subtitle: colecalciferol}}
Template:Short description Template:Cs1 config Template:Good article Template:Distinguish Template:Use dmy dates Template:Infobox drug
Introduction
Welcome to the fascinating world of Vitamin D! This essential nutrient plays a crucial role in maintaining our overall health and well-being. From its discovery to its various forms and applications, Vitamin D has proven to be a star player in the realm of human nutrition. File:white capsule in grass.png
History
The journey of Vitamin D began in the early 20th century when scientists embarked on a quest to understand the causes of rickets, a debilitating bone disease. The breakthrough came with the realization that exposure to sunlight played a pivotal role in preventing this condition. Subsequent research led to the identification of Vitamin D and its vital role in calcium metabolism.
Chemical Structure
At its core, Vitamin D refers to a group of fat-soluble secosteroids, with the two major forms being Vitamin D2 (ergocalciferol) and Vitamin D3 (cholecalciferol). The unique molecular structure enables these compounds to regulate calcium and phosphorus levels in the body, crucial for bone health.
Variants
Exploring the Vitamin D family reveals a spectrum of related compounds. Vitamin D2, sourced from fungi and plants, contrasts with Vitamin D3, synthesized in the skin upon exposure to sunlight. Understanding these variants is key for tailoring nutritional recommendations to different dietary preferences and lifestyles.
Synergistic compounds
Vitamin K2
Dosages
Determining the right dosage of Vitamin D is pivotal for maintaining optimal health. For beginners, a balance between sun exposure, dietary intake, and supplements can contribute to meeting recommended levels. For enthusiasts, delving into specific age groups, conditions, and geographical considerations provides a more nuanced understanding.
Effects
Vitamin D is not just a bone-strengthening superhero; it plays a multifaceted role in our health. From immune system support to mood regulation, the positive effects are vast. However, like any superhero, an imbalance can lead to issues. It's crucial to strike the right balance and be aware of potential side effects.
Medical Uses
The medical applications of Vitamin D extend beyond preventing rickets. Healthcare professionals leverage its properties in treating conditions such as osteoporosis, autoimmune diseases, and even certain cancers. Practical insights into how Vitamin D is used in real-world medical scenarios shed light on its far-reaching impact.
Risks
Understanding the risks associated with Vitamin D is paramount. While deficiency can lead to various health issues, excessive intake poses risks as well. This section breaks down potential side effects, helping readers make informed decisions about their Vitamin D intake.
Legal Status
Vitamin D supplements are widely available, but their legal status can vary across regions. Navigating the regulations ensures that individuals can access these supplements safely and responsibly, keeping in mind their impact on health and well-being.
Product Suggestions
Curious about incorporating more Vitamin D into your life? From fortified foods to supplements, there's a variety of options. Popular products and recommendations cater to different preferences, making it easier for readers to find what suits them best.
References
Conclude your exploration of Vitamin D with a comprehensive list of references, ensuring that readers can delve deeper into the world of this essential nutrient with confidence. Remember, your journey with Vitamin D is just beginning, so embrace the knowledge and let it illuminate your path to a healthier life!